C14H20N2O3 — CID 60733422
1-(3,3-dimethyl-2-oxobutyl)-3-(3-methoxyphenyl)urea (PubChem CID 60733422) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-(3,3-dimethyl-2-oxobutyl)-3-(3-methoxyphenyl)urea.
| Compound Name | 1-(3,3-dimethyl-2-oxobutyl)-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 60733422 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 1-(3,3-dimethyl-2-oxobutyl)-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)NCC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C14H20N2O3/c1-14(2,3)12(17)9-15-13(18)16-10-6-5-7-11(8-10)19-4/h5-8H,9H2,1-4H3,(H2,15,16,18) |
| InChIKey | KYYYSTQDMHWSLZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |