C14H23N3O3 — CID 103839105
1-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-3-(3-methoxyphenyl)urea (PubChem CID 103839105) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 103839105 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 1-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)NCC(C)(O)CN(C)C)c1 |
| InChI | InChI=1S/C14H23N3O3/c1-14(19,10-17(2)3)9-15-13(18)16-11-6-5-7-12(8-11)20-4/h5-8,19H,9-10H2,1-4H3,(H2,15,16,18) |
| InChIKey | XKOZGGJIWLOKGA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |