C19H23N3O3 — CID 51488436
2-[(3-methoxyphenyl)carbamoylamino]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 51488436) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-[(3-methoxyphenyl)carbamoylamino]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[(3-methoxyphenyl)carbamoylamino]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 51488436 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 2-[(3-methoxyphenyl)carbamoylamino]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | COc1cccc(NC(=O)NCC(=O)Nc2c(C)cc(C)cc2C)c1 |
| InChI | InChI=1S/C19H23N3O3/c1-12-8-13(2)18(14(3)9-12)22-17(23)11-20-19(24)21-15-6-5-7-16(10-15)25-4/h5-10H,11H2,1-4H3,(H,22,23)(H2,20,21,24) |
| InChIKey | GROGIVCMEUHTLO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |