C9H17F3N2O2S — CID 95980457
1-[2-[(R)-tert-butylsulfinyl]ethyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 95980457) has the molecular formula C9H17F3N2O2S and a molecular weight of 274.31 g/mol. Its IUPAC name is 1-[2-[(R)-tert-butylsulfinyl]ethyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[2-[(R)-tert-butylsulfinyl]ethyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 95980457 |
| Molecular Formula | C9H17F3N2O2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-[2-[(R)-tert-butylsulfinyl]ethyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CC(C)(C)[S@](=O)CCNC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O2S/c1-8(2,3)17(16)5-4-13-7(15)14-6-9(10,11)12/h4-6H2,1-3H3,(H2,13,14,15)/t17-/m1/s1 |
| InChIKey | PWNUNPWMPXKISV-QGZVFWFLSA-N |
| XLogP | 1.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |