C7H13F3N2O2S — CID 115629363
1-(2-ethylsulfinylethyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 115629363) has the molecular formula C7H13F3N2O2S and a molecular weight of 246.25 g/mol. Its IUPAC name is 1-(2-ethylsulfinylethyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(2-ethylsulfinylethyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 115629363 |
| Molecular Formula | C7H13F3N2O2S |
| Molecular Weight | 246.25 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 1-(2-ethylsulfinylethyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CCS(=O)CCNC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C7H13F3N2O2S/c1-2-15(14)4-3-11-6(13)12-5-7(8,9)10/h2-5H2,1H3,(H2,11,12,13) |
| InChIKey | FDYXPIITDPQSNG-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |