C18H18N4O2 — CID 95980741
N-[(1R,2S)-2-imidazol-1-ylcyclopentyl]-1-oxo-2H-isoquinoline-3-carboxamide (PubChem CID 95980741) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is N-[(1R,2S)-2-imidazol-1-ylcyclopentyl]-1-oxo-2H-isoquinoline-3-carboxamide.
| Compound Name | N-[(1R,2S)-2-imidazol-1-ylcyclopentyl]-1-oxo-2H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 95980741 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | N-[(1R,2S)-2-imidazol-1-ylcyclopentyl]-1-oxo-2H-isoquinoline-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCC[C@@H]1n1ccnc1)c1cc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C18H18N4O2/c23-17-13-5-2-1-4-12(13)10-15(21-17)18(24)20-14-6-3-7-16(14)22-9-8-19-11-22/h1-2,4-5,8-11,14,16H,3,6-7H2,(H,20,24)(H,21,23)/t14-,16+/m1/s1 |
| InChIKey | LXSNSQYZRRMLKK-ZBFHGGJFSA-N |
| XLogP | 2.25 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |