C24H24N4O — CID 95571320
1-benzyl-N-[(1R,2R)-2-imidazol-1-ylcyclopentyl]indole-2-carboxamide (PubChem CID 95571320) has the molecular formula C24H24N4O and a molecular weight of 384.48 g/mol. Its IUPAC name is 1-benzyl-N-[(1R,2R)-2-imidazol-1-ylcyclopentyl]indole-2-carboxamide.
| Compound Name | 1-benzyl-N-[(1R,2R)-2-imidazol-1-ylcyclopentyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 95571320 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 1-benzyl-N-[(1R,2R)-2-imidazol-1-ylcyclopentyl]indole-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCC[C@H]1n1ccnc1)c1cc2ccccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C24H24N4O/c29-24(26-20-10-6-12-22(20)27-14-13-25-17-27)23-15-19-9-4-5-11-21(19)28(23)16-18-7-2-1-3-8-18/h1-5,7-9,11,13-15,17,20,22H,6,10,12,16H2,(H,26,29)/t20-,22-/m1/s1 |
| InChIKey | FGJACCVOCGVDDD-IFMALSPDSA-N |
| XLogP | 4.41 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |