C14H22N4O4S — CID 95981827
4-[[(1S,2S)-2-(dimethylamino)cyclopentyl]amino]-N-methyl-3-nitrobenzenesulfonamide (PubChem CID 95981827) has the molecular formula C14H22N4O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is 4-[[(1S,2S)-2-(dimethylamino)cyclopentyl]amino]-N-methyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[[(1S,2S)-2-(dimethylamino)cyclopentyl]amino]-N-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 95981827 |
| Molecular Formula | C14H22N4O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 4-[[(1S,2S)-2-(dimethylamino)cyclopentyl]amino]-N-methyl-3-nitrobenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(N[C@H]2CCC[C@@H]2N(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H22N4O4S/c1-15-23(21,22)10-7-8-12(14(9-10)18(19)20)16-11-5-4-6-13(11)17(2)3/h7-9,11,13,15-16H,4-6H2,1-3H3/t11-,13-/m0/s1 |
| InChIKey | ZCOVCHQHEVJHFM-AAEUAGOBSA-N |
| XLogP | 1.40 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|