C16H20N2O5 — CID 95983787
1-(2,3-dimethoxyphenyl)-3-[(2R)-2-(furan-2-yl)-2-hydroxypropyl]urea (PubChem CID 95983787) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is 1-(2,3-dimethoxyphenyl)-3-[(2R)-2-(furan-2-yl)-2-hydroxypropyl]urea.
| Compound Name | 1-(2,3-dimethoxyphenyl)-3-[(2R)-2-(furan-2-yl)-2-hydroxypropyl]urea |
|---|---|
| PubChem CID | 95983787 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 1-(2,3-dimethoxyphenyl)-3-[(2R)-2-(furan-2-yl)-2-hydroxypropyl]urea |
| SMILES | COc1cccc(NC(=O)NC[C@@](C)(O)c2ccco2)c1OC |
| InChI | InChI=1S/C16H20N2O5/c1-16(20,13-8-5-9-23-13)10-17-15(19)18-11-6-4-7-12(21-2)14(11)22-3/h4-9,20H,10H2,1-3H3,(H2,17,18,19)/t16-/m1/s1 |
| InChIKey | RRWRYQFDUKBOFR-MRXNPFEDSA-N |
| XLogP | 2.33 |
| TPSA | 92.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |