About (1R,4R)-5-(3,4-difluorobenzoyl)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one
(1R,4R)-5-(3,4-difluorobenzoyl)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one (PubChem CID 95985306) has the molecular formula C12H9F2NO3
and a molecular weight of 253.20 g/mol. Its IUPAC name is (1R,4R)-5-(3,4-difluorobenzoyl)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one.
Molecular Properties
| Compound Name | (1R,4R)-5-(3,4-difluorobenzoyl)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one |
| PubChem CID | 95985306 |
| Molecular Formula | C12H9F2NO3 |
| Molecular Weight | 253.20 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | (1R,4R)-5-(3,4-difluorobenzoyl)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one |
| SMILES | O=C1O[C@@H]2C[C@H]1N(C(=O)c1ccc(F)c(F)c1)C2 |
| InChI | InChI=1S/C12H9F2NO3/c13-8-2-1-6(3-9(8)14)11(16)15-5-7-4-10(15)12(17)18-7/h1-3,7,10H,4-5H2/t7-,10-/m1/s1 |
| InChIKey | WMDBJUMXCRNHDG-GMSGAONNSA-N |
| XLogP | 1.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R,4R)-5-(3,4-difluorobenzoyl)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,4R)-5-(3,4-difluorobenzoyl)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one?
The IUPAC name of (1R,4R)-5-(3,4-difluorobenzoyl)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one (CID 95985306) is (1R,4R)-5-(3,4-difluorobenzoyl)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one.
What is the SMILES notation for (1R,4R)-5-(3,4-difluorobenzoyl)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one?
The canonical SMILES for (1R,4R)-5-(3,4-difluorobenzoyl)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one is O=C1O[C@@H]2C[C@H]1N(C(=O)c1ccc(F)c(F)c1)C2.
What is the InChIKey of (1R,4R)-5-(3,4-difluorobenzoyl)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one?
The InChIKey is WMDBJUMXCRNHDG-GMSGAONNSA-N. The full InChI is InChI=1S/C12H9F2NO3/c13-8-2-1-6(3-9(8)14)11(16)15-5-7-4-10(15)12(17)18-7/h1-3,7,10H,4-5H2/t7-,10-/m1/s1.
What are the key properties of (1R,4R)-5-(3,4-difluorobenzoyl)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one?
(1R,4R)-5-(3,4-difluorobenzoyl)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one has a molecular weight of 253.20 g/mol, XLogP of 1.10, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,4R)-5-(3,4-difluorobenzoyl)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one is sourced from PubChem (CID 95985306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).