C14H16FN5O — CID 95985448
[2-(4-fluorophenyl)tetrazol-5-yl]-[(2S)-2-methylpiperidin-1-yl]methanone (PubChem CID 95985448) has the molecular formula C14H16FN5O and a molecular weight of 289.31 g/mol. Its IUPAC name is [2-(4-fluorophenyl)tetrazol-5-yl]-[(2S)-2-methylpiperidin-1-yl]methanone.
| Compound Name | [2-(4-fluorophenyl)tetrazol-5-yl]-[(2S)-2-methylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95985448 |
| Molecular Formula | C14H16FN5O |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | [2-(4-fluorophenyl)tetrazol-5-yl]-[(2S)-2-methylpiperidin-1-yl]methanone |
| SMILES | C[C@H]1CCCCN1C(=O)c1nnn(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C14H16FN5O/c1-10-4-2-3-9-19(10)14(21)13-16-18-20(17-13)12-7-5-11(15)6-8-12/h5-8,10H,2-4,9H2,1H3/t10-/m0/s1 |
| InChIKey | YNGRYDOQGVKWEJ-JTQLQIEISA-N |
| XLogP | 1.82 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |