C15H20N2O3 — CID 95986991
(Z)-2-cyano-3-(furan-2-yl)-N-[(2S,3R)-2-hydroxy-2,3-dimethylpentyl]prop-2-enamide (PubChem CID 95986991) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is (Z)-2-cyano-3-(furan-2-yl)-N-[(2S,3R)-2-hydroxy-2,3-dimethylpentyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(furan-2-yl)-N-[(2S,3R)-2-hydroxy-2,3-dimethylpentyl]prop-2-enamide |
|---|---|
| PubChem CID | 95986991 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (Z)-2-cyano-3-(furan-2-yl)-N-[(2S,3R)-2-hydroxy-2,3-dimethylpentyl]prop-2-enamide |
| SMILES | CC[C@@H](C)[C@](C)(O)CNC(=O)/C(C#N)=C\c1ccco1 |
| InChI | InChI=1S/C15H20N2O3/c1-4-11(2)15(3,19)10-17-14(18)12(9-16)8-13-6-5-7-20-13/h5-8,11,19H,4,10H2,1-3H3,(H,17,18)/b12-8-/t11-,15-/m1/s1 |
| InChIKey | HGTROHKIJPHMEP-RNJQCAHHSA-N |
| XLogP | 2.10 |
| TPSA | 86.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|