C22H22N4O4 — CID 72660889
2-cyano-3-(furan-2-yl)-N-[6-[[3-(furan-2-yl)-2-isocyanoprop-2-enoyl]amino]hexyl]prop-2-enamide (PubChem CID 72660889) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is 2-cyano-3-(furan-2-yl)-N-[6-[[3-(furan-2-yl)-2-isocyanoprop-2-enoyl]amino]hexyl]prop-2-enamide.
| Compound Name | 2-cyano-3-(furan-2-yl)-N-[6-[[3-(furan-2-yl)-2-isocyanoprop-2-enoyl]amino]hexyl]prop-2-enamide |
|---|---|
| PubChem CID | 72660889 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 2-cyano-3-(furan-2-yl)-N-[6-[[3-(furan-2-yl)-2-isocyanoprop-2-enoyl]amino]hexyl]prop-2-enamide |
| SMILES | [C-]#[N+]C(=Cc1ccco1)C(=O)NCCCCCCNC(=O)C(C#N)=Cc1ccco1 |
| InChI | InChI=1S/C22H22N4O4/c1-24-20(15-19-9-7-13-30-19)22(28)26-11-5-3-2-4-10-25-21(27)17(16-23)14-18-8-6-12-29-18/h6-9,12-15H,2-5,10-11H2,(H,25,27)(H,26,28) |
| InChIKey | GFIASIXLTMCKIV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|