C17H18N2O — CID 962404
5,6-dimethyl-1-(2-phenoxyethyl)benzimidazole (PubChem CID 962404) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 5,6-dimethyl-1-(2-phenoxyethyl)benzimidazole.
| Compound Name | 5,6-dimethyl-1-(2-phenoxyethyl)benzimidazole |
|---|---|
| PubChem CID | 962404 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 5,6-dimethyl-1-(2-phenoxyethyl)benzimidazole |
| SMILES | Cc1cc2ncn(CCOc3ccccc3)c2cc1C |
| InChI | InChI=1S/C17H18N2O/c1-13-10-16-17(11-14(13)2)19(12-18-16)8-9-20-15-6-4-3-5-7-15/h3-7,10-12H,8-9H2,1-2H3 |
| InChIKey | YGWKWAAOMKWUQY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |