C5H4F8O — CID 9641
2,2,3,3,4,4,5,5-octafluoropentan-1-ol (PubChem CID 9641) has the molecular formula C5H4F8O and a molecular weight of 232.07 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoropentan-1-ol.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoropentan-1-ol |
|---|---|
| PubChem CID | 9641 |
| Molecular Formula | C5H4F8O |
| Molecular Weight | 232.07 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentan-1-ol |
| SMILES | OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C5H4F8O/c6-2(7)4(10,11)5(12,13)3(8,9)1-14/h2,14H,1H2 |
| InChIKey | JUGSKHLZINSXPQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.07 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|