C11H22N2O3S — CID 96502385
N-[2-[(S)-tert-butylsulfinyl]ethyl]morpholine-4-carboxamide (PubChem CID 96502385) has the molecular formula C11H22N2O3S and a molecular weight of 262.37 g/mol. Its IUPAC name is N-[2-[(S)-tert-butylsulfinyl]ethyl]morpholine-4-carboxamide.
| Compound Name | N-[2-[(S)-tert-butylsulfinyl]ethyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 96502385 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | N-[2-[(S)-tert-butylsulfinyl]ethyl]morpholine-4-carboxamide |
| SMILES | CC(C)(C)[S@@](=O)CCNC(=O)N1CCOCC1 |
| InChI | InChI=1S/C11H22N2O3S/c1-11(2,3)17(15)9-4-12-10(14)13-5-7-16-8-6-13/h4-9H2,1-3H3,(H,12,14)/t17-/m0/s1 |
| InChIKey | IMYULPNDAJHJDG-KRWDZBQOSA-N |
| XLogP | 0.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |