C14H28N2O3S — CID 99824844
(2R)-N-[2-[(S)-tert-butylsulfinyl]ethyl]-2-ethyl-2-methylmorpholine-4-carboxamide (PubChem CID 99824844) has the molecular formula C14H28N2O3S and a molecular weight of 304.46 g/mol. Its IUPAC name is (2R)-N-[2-[(S)-tert-butylsulfinyl]ethyl]-2-ethyl-2-methylmorpholine-4-carboxamide.
| Compound Name | (2R)-N-[2-[(S)-tert-butylsulfinyl]ethyl]-2-ethyl-2-methylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 99824844 |
| Molecular Formula | C14H28N2O3S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | (2R)-N-[2-[(S)-tert-butylsulfinyl]ethyl]-2-ethyl-2-methylmorpholine-4-carboxamide |
| SMILES | CC[C@]1(C)CN(C(=O)NCC[S@](=O)C(C)(C)C)CCO1 |
| InChI | InChI=1S/C14H28N2O3S/c1-6-14(5)11-16(8-9-19-14)12(17)15-7-10-20(18)13(2,3)4/h6-11H2,1-5H3,(H,15,17)/t14-,20+/m1/s1 |
| InChIKey | FQRWREJJTKDXPL-VLIAUNLRSA-N |
| XLogP | 1.74 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |