C15H15N3O2 — CID 96506885
N-[(3R)-1-methyl-2-oxopyrrolidin-3-yl]quinoline-2-carboxamide (PubChem CID 96506885) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is N-[(3R)-1-methyl-2-oxopyrrolidin-3-yl]quinoline-2-carboxamide.
| Compound Name | N-[(3R)-1-methyl-2-oxopyrrolidin-3-yl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 96506885 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-[(3R)-1-methyl-2-oxopyrrolidin-3-yl]quinoline-2-carboxamide |
| SMILES | CN1CC[C@@H](NC(=O)c2ccc3ccccc3n2)C1=O |
| InChI | InChI=1S/C15H15N3O2/c1-18-9-8-13(15(18)20)17-14(19)12-7-6-10-4-2-3-5-11(10)16-12/h2-7,13H,8-9H2,1H3,(H,17,19)/t13-/m1/s1 |
| InChIKey | LSOQCIPQOUTCBB-CYBMUJFWSA-N |
| XLogP | 1.20 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |