C21H26N4O3S — CID 96509525
N-[(3R)-1-[(4-phenylmethoxyindazol-1-yl)methyl]piperidin-3-yl]methanesulfonamide (PubChem CID 96509525) has the molecular formula C21H26N4O3S and a molecular weight of 414.53 g/mol. Its IUPAC name is N-[(3R)-1-[(4-phenylmethoxyindazol-1-yl)methyl]piperidin-3-yl]methanesulfonamide.
| Compound Name | N-[(3R)-1-[(4-phenylmethoxyindazol-1-yl)methyl]piperidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 96509525 |
| Molecular Formula | C21H26N4O3S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | N-[(3R)-1-[(4-phenylmethoxyindazol-1-yl)methyl]piperidin-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@@H]1CCCN(Cn2ncc3c(OCc4ccccc4)cccc32)C1 |
| InChI | InChI=1S/C21H26N4O3S/c1-29(26,27)23-18-9-6-12-24(14-18)16-25-20-10-5-11-21(19(20)13-22-25)28-15-17-7-3-2-4-8-17/h2-5,7-8,10-11,13,18,23H,6,9,12,14-16H2,1H3/t18-/m1/s1 |
| InChIKey | OMKJEESZVAZPNW-GOSISDBHSA-N |
| XLogP | 2.59 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |