C15H24N2O4S — CID 96510791
(2R)-N-ethyl-2-(furan-2-yl)-N-[[(3S)-oxolan-3-yl]methyl]pyrrolidine-1-sulfonamide (PubChem CID 96510791) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is (2R)-N-ethyl-2-(furan-2-yl)-N-[[(3S)-oxolan-3-yl]methyl]pyrrolidine-1-sulfonamide.
| Compound Name | (2R)-N-ethyl-2-(furan-2-yl)-N-[[(3S)-oxolan-3-yl]methyl]pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 96510791 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (2R)-N-ethyl-2-(furan-2-yl)-N-[[(3S)-oxolan-3-yl]methyl]pyrrolidine-1-sulfonamide |
| SMILES | CCN(C[C@@H]1CCOC1)S(=O)(=O)N1CCC[C@@H]1c1ccco1 |
| InChI | InChI=1S/C15H24N2O4S/c1-2-16(11-13-7-10-20-12-13)22(18,19)17-8-3-5-14(17)15-6-4-9-21-15/h4,6,9,13-14H,2-3,5,7-8,10-12H2,1H3/t13-,14+/m0/s1 |
| InChIKey | CBLOVMRAVBBASM-UONOGXRCSA-N |
| XLogP | 2.02 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |