C17H24N2O3S — CID 96511044
(3aR,7aS)-2-[(2S)-2-(5-methylfuran-2-yl)pyrrolidin-1-yl]sulfonyl-1,3,3a,4,7,7a-hexahydroisoindole (PubChem CID 96511044) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is (3aR,7aS)-2-[(2S)-2-(5-methylfuran-2-yl)pyrrolidin-1-yl]sulfonyl-1,3,3a,4,7,7a-hexahydroisoindole.
| Compound Name | (3aR,7aS)-2-[(2S)-2-(5-methylfuran-2-yl)pyrrolidin-1-yl]sulfonyl-1,3,3a,4,7,7a-hexahydroisoindole |
|---|---|
| PubChem CID | 96511044 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (3aR,7aS)-2-[(2S)-2-(5-methylfuran-2-yl)pyrrolidin-1-yl]sulfonyl-1,3,3a,4,7,7a-hexahydroisoindole |
| SMILES | Cc1ccc([C@@H]2CCCN2S(=O)(=O)N2C[C@H]3CC=CC[C@H]3C2)o1 |
| InChI | InChI=1S/C17H24N2O3S/c1-13-8-9-17(22-13)16-7-4-10-19(16)23(20,21)18-11-14-5-2-3-6-15(14)12-18/h2-3,8-9,14-16H,4-7,10-12H2,1H3/t14-,15+,16-/m0/s1 |
| InChIKey | IMWKOTOLYVWYBI-XHSDSOJGSA-N |
| XLogP | 2.87 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|