C18H29NO4S — CID 124888744
(2R)-1-[(2S)-3-cyclopentyloxy-2-methylpropyl]sulfonyl-2-(5-methylfuran-2-yl)pyrrolidine (PubChem CID 124888744) has the molecular formula C18H29NO4S and a molecular weight of 355.50 g/mol. Its IUPAC name is (2R)-1-[(2S)-3-cyclopentyloxy-2-methylpropyl]sulfonyl-2-(5-methylfuran-2-yl)pyrrolidine.
| Compound Name | (2R)-1-[(2S)-3-cyclopentyloxy-2-methylpropyl]sulfonyl-2-(5-methylfuran-2-yl)pyrrolidine |
|---|---|
| PubChem CID | 124888744 |
| Molecular Formula | C18H29NO4S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | (2R)-1-[(2S)-3-cyclopentyloxy-2-methylpropyl]sulfonyl-2-(5-methylfuran-2-yl)pyrrolidine |
| SMILES | Cc1ccc([C@H]2CCCN2S(=O)(=O)C[C@@H](C)COC2CCCC2)o1 |
| InChI | InChI=1S/C18H29NO4S/c1-14(12-22-16-6-3-4-7-16)13-24(20,21)19-11-5-8-17(19)18-10-9-15(2)23-18/h9-10,14,16-17H,3-8,11-13H2,1-2H3/t14-,17+/m0/s1 |
| InChIKey | SPAZGYZDCDPWPM-WMLDXEAASA-N |
| XLogP | 3.65 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |