C12H19NO — CID 157179926
2-(5-methylfuran-2-yl)-1-propan-2-ylpyrrolidine (PubChem CID 157179926) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-(5-methylfuran-2-yl)-1-propan-2-ylpyrrolidine.
| Compound Name | 2-(5-methylfuran-2-yl)-1-propan-2-ylpyrrolidine |
|---|---|
| PubChem CID | 157179926 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 2-(5-methylfuran-2-yl)-1-propan-2-ylpyrrolidine |
| SMILES | Cc1ccc(C2CCCN2C(C)C)o1 |
| InChI | InChI=1S/C12H19NO/c1-9(2)13-8-4-5-11(13)12-7-6-10(3)14-12/h6-7,9,11H,4-5,8H2,1-3H3 |
| InChIKey | BJZUHJUBYJNGLX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |