C18H16BrN3O2 — CID 96514664
methyl (2R)-3-[(6-bromoquinazolin-4-yl)amino]-2-phenylpropanoate (PubChem CID 96514664) has the molecular formula C18H16BrN3O2 and a molecular weight of 386.25 g/mol. Its IUPAC name is methyl (2R)-3-[(6-bromoquinazolin-4-yl)amino]-2-phenylpropanoate.
| Compound Name | methyl (2R)-3-[(6-bromoquinazolin-4-yl)amino]-2-phenylpropanoate |
|---|---|
| PubChem CID | 96514664 |
| Molecular Formula | C18H16BrN3O2 |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | methyl (2R)-3-[(6-bromoquinazolin-4-yl)amino]-2-phenylpropanoate |
| SMILES | COC(=O)[C@@H](CNc1ncnc2ccc(Br)cc12)c1ccccc1 |
| InChI | InChI=1S/C18H16BrN3O2/c1-24-18(23)15(12-5-3-2-4-6-12)10-20-17-14-9-13(19)7-8-16(14)21-11-22-17/h2-9,11,15H,10H2,1H3,(H,20,21,22)/t15-/m0/s1 |
| InChIKey | NBGMXZWZNGHOHK-HNNXBMFYSA-N |
| XLogP | 3.76 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |