C17H31N3O3 — CID 96516498
(2S,6S)-N-[2-[(2-cyclopentylacetyl)amino]ethyl]-2-ethyl-6-methylmorpholine-4-carboxamide (PubChem CID 96516498) has the molecular formula C17H31N3O3 and a molecular weight of 325.45 g/mol. Its IUPAC name is (2S,6S)-N-[2-[(2-cyclopentylacetyl)amino]ethyl]-2-ethyl-6-methylmorpholine-4-carboxamide.
| Compound Name | (2S,6S)-N-[2-[(2-cyclopentylacetyl)amino]ethyl]-2-ethyl-6-methylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 96516498 |
| Molecular Formula | C17H31N3O3 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | (2S,6S)-N-[2-[(2-cyclopentylacetyl)amino]ethyl]-2-ethyl-6-methylmorpholine-4-carboxamide |
| SMILES | CC[C@H]1CN(C(=O)NCCNC(=O)CC2CCCC2)C[C@H](C)O1 |
| InChI | InChI=1S/C17H31N3O3/c1-3-15-12-20(11-13(2)23-15)17(22)19-9-8-18-16(21)10-14-6-4-5-7-14/h13-15H,3-12H2,1-2H3,(H,18,21)(H,19,22)/t13-,15-/m0/s1 |
| InChIKey | XHINUBBTYIQSLL-ZFWWWQNUSA-N |
| XLogP | 1.89 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|