C13H26N2O4 — CID 96516458
(2R,6S)-2-ethyl-N-[2-(2-methoxyethoxy)ethyl]-6-methylmorpholine-4-carboxamide (PubChem CID 96516458) has the molecular formula C13H26N2O4 and a molecular weight of 274.36 g/mol. Its IUPAC name is (2R,6S)-2-ethyl-N-[2-(2-methoxyethoxy)ethyl]-6-methylmorpholine-4-carboxamide.
| Compound Name | (2R,6S)-2-ethyl-N-[2-(2-methoxyethoxy)ethyl]-6-methylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 96516458 |
| Molecular Formula | C13H26N2O4 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (2R,6S)-2-ethyl-N-[2-(2-methoxyethoxy)ethyl]-6-methylmorpholine-4-carboxamide |
| SMILES | CC[C@@H]1CN(C(=O)NCCOCCOC)C[C@H](C)O1 |
| InChI | InChI=1S/C13H26N2O4/c1-4-12-10-15(9-11(2)19-12)13(16)14-5-6-18-8-7-17-3/h11-12H,4-10H2,1-3H3,(H,14,16)/t11-,12+/m0/s1 |
| InChIKey | BULJWOWMTLLMAG-NWDGAFQWSA-N |
| XLogP | 0.86 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|