C15H29N3O4 — CID 163339993
(1R,5S)-N-(3-ethoxypropyl)-7-(2-methoxyethyl)-9-oxa-3,7-diazabicyclo[3.3.1]nonane-3-carboxamide (PubChem CID 163339993) has the molecular formula C15H29N3O4 and a molecular weight of 315.41 g/mol. Its IUPAC name is (1R,5S)-N-(3-ethoxypropyl)-7-(2-methoxyethyl)-9-oxa-3,7-diazabicyclo[3.3.1]nonane-3-carboxamide.
| Compound Name | (1R,5S)-N-(3-ethoxypropyl)-7-(2-methoxyethyl)-9-oxa-3,7-diazabicyclo[3.3.1]nonane-3-carboxamide |
|---|---|
| PubChem CID | 163339993 |
| Molecular Formula | C15H29N3O4 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | (1R,5S)-N-(3-ethoxypropyl)-7-(2-methoxyethyl)-9-oxa-3,7-diazabicyclo[3.3.1]nonane-3-carboxamide |
| SMILES | CCOCCCNC(=O)N1C[C@H]2CN(CCOC)C[C@@H](C1)O2 |
| InChI | InChI=1S/C15H29N3O4/c1-3-21-7-4-5-16-15(19)18-11-13-9-17(6-8-20-2)10-14(12-18)22-13/h13-14H,3-12H2,1-2H3,(H,16,19)/t13-,14+ |
| InChIKey | CRWDFXRNUQQMFQ-OKILXGFUSA-N |
| XLogP | 0.15 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|