C17H20N2O2S — CID 96517758
1-[(3R)-3-(5-methylfuran-2-yl)thiomorpholin-4-yl]-3-pyridin-3-ylpropan-1-one (PubChem CID 96517758) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is 1-[(3R)-3-(5-methylfuran-2-yl)thiomorpholin-4-yl]-3-pyridin-3-ylpropan-1-one.
| Compound Name | 1-[(3R)-3-(5-methylfuran-2-yl)thiomorpholin-4-yl]-3-pyridin-3-ylpropan-1-one |
|---|---|
| PubChem CID | 96517758 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 1-[(3R)-3-(5-methylfuran-2-yl)thiomorpholin-4-yl]-3-pyridin-3-ylpropan-1-one |
| SMILES | Cc1ccc([C@@H]2CSCCN2C(=O)CCc2cccnc2)o1 |
| InChI | InChI=1S/C17H20N2O2S/c1-13-4-6-16(21-13)15-12-22-10-9-19(15)17(20)7-5-14-3-2-8-18-11-14/h2-4,6,8,11,15H,5,7,9-10,12H2,1H3/t15-/m0/s1 |
| InChIKey | IZAOYVBYTFDEIN-HNNXBMFYSA-N |
| XLogP | 3.23 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |