C17H24N2O2S — CID 96519273
cis-(1S,2R)-2-[[2-(3-phenylpropylsulfanyl)acetyl]amino]cyclopentane-1-carboxamide (PubChem CID 96519273) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is cis-(1S,2R)-2-[[2-(3-phenylpropylsulfanyl)acetyl]amino]cyclopentane-1-carboxamide.
| Compound Name | cis-(1S,2R)-2-[[2-(3-phenylpropylsulfanyl)acetyl]amino]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 96519273 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | cis-(1S,2R)-2-[[2-(3-phenylpropylsulfanyl)acetyl]amino]cyclopentane-1-carboxamide |
| SMILES | NC(=O)[C@H]1CCC[C@H]1NC(=O)CSCCCc1ccccc1 |
| InChI | InChI=1S/C17H24N2O2S/c18-17(21)14-9-4-10-15(14)19-16(20)12-22-11-5-8-13-6-2-1-3-7-13/h1-3,6-7,14-15H,4-5,8-12H2,(H2,18,21)(H,19,20)/t14-,15+/m0/s1 |
| InChIKey | HMNHVAUGUILJAC-LSDHHAIUSA-N |
| XLogP | 2.12 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|