C24H38N4O2 — CID 96520588
1-[(1S,3S)-3-ethoxyspiro[3.5]nonan-1-yl]-3-[2-(4-ethylpiperazin-1-yl)phenyl]urea (PubChem CID 96520588) has the molecular formula C24H38N4O2 and a molecular weight of 414.59 g/mol. Its IUPAC name is 1-[(1S,3S)-3-ethoxyspiro[3.5]nonan-1-yl]-3-[2-(4-ethylpiperazin-1-yl)phenyl]urea.
| Compound Name | 1-[(1S,3S)-3-ethoxyspiro[3.5]nonan-1-yl]-3-[2-(4-ethylpiperazin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 96520588 |
| Molecular Formula | C24H38N4O2 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | 1-[(1S,3S)-3-ethoxyspiro[3.5]nonan-1-yl]-3-[2-(4-ethylpiperazin-1-yl)phenyl]urea |
| SMILES | CCO[C@H]1C[C@H](NC(=O)Nc2ccccc2N2CCN(CC)CC2)C12CCCCC2 |
| InChI | InChI=1S/C24H38N4O2/c1-3-27-14-16-28(17-15-27)20-11-7-6-10-19(20)25-23(29)26-21-18-22(30-4-2)24(21)12-8-5-9-13-24/h6-7,10-11,21-22H,3-5,8-9,12-18H2,1-2H3,(H2,25,26,29)/t21-,22-/m0/s1 |
| InChIKey | JREPFTXWLVOGFN-VXKWHMMOSA-N |
| XLogP | 4.08 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |