About [(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] (2R)-1-butanoylpyrrolidine-2-carboxylate
[(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] (2R)-1-butanoylpyrrolidine-2-carboxylate (PubChem CID 96523805) has the molecular formula C14H21N3O4
and a molecular weight of 295.34 g/mol. Its IUPAC name is [(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] (2R)-1-butanoylpyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | [(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] (2R)-1-butanoylpyrrolidine-2-carboxylate |
| PubChem CID | 96523805 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | [(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] (2R)-1-butanoylpyrrolidine-2-carboxylate |
| SMILES | CCCC(=O)N1CCC[C@@H]1C(=O)O[C@@H](C)c1nc(C)no1 |
| InChI | InChI=1S/C14H21N3O4/c1-4-6-12(18)17-8-5-7-11(17)14(19)20-9(2)13-15-10(3)16-21-13/h9,11H,4-8H2,1-3H3/t9-,11+/m0/s1 |
| InChIKey | JUUJGDIDAJBLEU-GXSJLCMTSA-N |
| XLogP | 1.77 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] (2R)-1-butanoylpyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] (2R)-1-butanoylpyrrolidine-2-carboxylate?
The IUPAC name of [(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] (2R)-1-butanoylpyrrolidine-2-carboxylate (CID 96523805) is [(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] (2R)-1-butanoylpyrrolidine-2-carboxylate.
What is the SMILES notation for [(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] (2R)-1-butanoylpyrrolidine-2-carboxylate?
The canonical SMILES for [(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] (2R)-1-butanoylpyrrolidine-2-carboxylate is CCCC(=O)N1CCC[C@@H]1C(=O)O[C@@H](C)c1nc(C)no1.
What is the InChIKey of [(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] (2R)-1-butanoylpyrrolidine-2-carboxylate?
The InChIKey is JUUJGDIDAJBLEU-GXSJLCMTSA-N. The full InChI is InChI=1S/C14H21N3O4/c1-4-6-12(18)17-8-5-7-11(17)14(19)20-9(2)13-15-10(3)16-21-13/h9,11H,4-8H2,1-3H3/t9-,11+/m0/s1.
What are the key properties of [(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] (2R)-1-butanoylpyrrolidine-2-carboxylate?
[(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] (2R)-1-butanoylpyrrolidine-2-carboxylate has a molecular weight of 295.34 g/mol, XLogP of 1.77, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] (2R)-1-butanoylpyrrolidine-2-carboxylate is sourced from PubChem (CID 96523805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).