C12H11F3N2O4S — CID 96526257
2-nitro-N-[(1R,3S)-1-oxothiolan-3-yl]-4-(trifluoromethyl)benzamide (PubChem CID 96526257) has the molecular formula C12H11F3N2O4S and a molecular weight of 336.29 g/mol. Its IUPAC name is 2-nitro-N-[(1R,3S)-1-oxothiolan-3-yl]-4-(trifluoromethyl)benzamide.
| Compound Name | 2-nitro-N-[(1R,3S)-1-oxothiolan-3-yl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 96526257 |
| Molecular Formula | C12H11F3N2O4S |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 2-nitro-N-[(1R,3S)-1-oxothiolan-3-yl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(N[C@H]1CC[S@](=O)C1)c1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11F3N2O4S/c13-12(14,15)7-1-2-9(10(5-7)17(19)20)11(18)16-8-3-4-22(21)6-8/h1-2,5,8H,3-4,6H2,(H,16,18)/t8-,22-/m0/s1 |
| InChIKey | JDSGICFWIMLVDQ-ZCAPAMDOSA-N |
| XLogP | 1.86 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|