C20H29N3O5 — CID 96528830
N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-3-[3-[(1S)-1-methoxyethyl]-1,2,4-oxadiazol-5-yl]propanamide (PubChem CID 96528830) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-3-[3-[(1S)-1-methoxyethyl]-1,2,4-oxadiazol-5-yl]propanamide.
| Compound Name | N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-3-[3-[(1S)-1-methoxyethyl]-1,2,4-oxadiazol-5-yl]propanamide |
|---|---|
| PubChem CID | 96528830 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-3-[3-[(1S)-1-methoxyethyl]-1,2,4-oxadiazol-5-yl]propanamide |
| SMILES | CCOCCOCc1cccc(CNC(=O)CCc2nc([C@H](C)OC)no2)c1 |
| InChI | InChI=1S/C20H29N3O5/c1-4-26-10-11-27-14-17-7-5-6-16(12-17)13-21-18(24)8-9-19-22-20(23-28-19)15(2)25-3/h5-7,12,15H,4,8-11,13-14H2,1-3H3,(H,21,24)/t15-/m0/s1 |
| InChIKey | YKXFHYPYLWSRPZ-HNNXBMFYSA-N |
| XLogP | 2.58 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|