C15H17ClN4O — CID 96529412
(3R)-1-(3-chlorophenyl)-3-[(5-methyl-1H-pyrazol-4-yl)methylamino]pyrrolidin-2-one (PubChem CID 96529412) has the molecular formula C15H17ClN4O and a molecular weight of 304.78 g/mol. Its IUPAC name is (3R)-1-(3-chlorophenyl)-3-[(5-methyl-1H-pyrazol-4-yl)methylamino]pyrrolidin-2-one.
| Compound Name | (3R)-1-(3-chlorophenyl)-3-[(5-methyl-1H-pyrazol-4-yl)methylamino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 96529412 |
| Molecular Formula | C15H17ClN4O |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (3R)-1-(3-chlorophenyl)-3-[(5-methyl-1H-pyrazol-4-yl)methylamino]pyrrolidin-2-one |
| SMILES | Cc1[nH]ncc1CN[C@@H]1CCN(c2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C15H17ClN4O/c1-10-11(9-18-19-10)8-17-14-5-6-20(15(14)21)13-4-2-3-12(16)7-13/h2-4,7,9,14,17H,5-6,8H2,1H3,(H,18,19)/t14-/m1/s1 |
| InChIKey | LHNBKWINZNMVJG-CQSZACIVSA-N |
| XLogP | 2.27 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |