C22H31N5O5 — CID 96529474
tert-butyl (4R,5S)-2,2,5-trimethyl-4-[[[2-methyl-5-(1,3,4-oxadiazol-2-yl)phenyl]carbamoylamino]methyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 96529474) has the molecular formula C22H31N5O5 and a molecular weight of 445.52 g/mol. Its IUPAC name is tert-butyl (4R,5S)-2,2,5-trimethyl-4-[[[2-methyl-5-(1,3,4-oxadiazol-2-yl)phenyl]carbamoylamino]methyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R,5S)-2,2,5-trimethyl-4-[[[2-methyl-5-(1,3,4-oxadiazol-2-yl)phenyl]carbamoylamino]methyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 96529474 |
| Molecular Formula | C22H31N5O5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | tert-butyl (4R,5S)-2,2,5-trimethyl-4-[[[2-methyl-5-(1,3,4-oxadiazol-2-yl)phenyl]carbamoylamino]methyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | Cc1ccc(-c2nnco2)cc1NC(=O)NC[C@@H]1[C@H](C)OC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H31N5O5/c1-13-8-9-15(18-26-24-12-30-18)10-16(13)25-19(28)23-11-17-14(2)31-22(6,7)27(17)20(29)32-21(3,4)5/h8-10,12,14,17H,11H2,1-7H3,(H2,23,25,28)/t14-,17+/m0/s1 |
| InChIKey | UTTZZMSIMQBJJL-WMLDXEAASA-N |
| XLogP | 3.93 |
| TPSA | 118.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |