C17H21ClN4O3 — CID 96529788
(2R)-2-[(9aR)-6,7-dioxo-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-N-[(2-chlorophenyl)methyl]propanamide (PubChem CID 96529788) has the molecular formula C17H21ClN4O3 and a molecular weight of 364.83 g/mol. Its IUPAC name is (2R)-2-[(9aR)-6,7-dioxo-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-N-[(2-chlorophenyl)methyl]propanamide.
| Compound Name | (2R)-2-[(9aR)-6,7-dioxo-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-N-[(2-chlorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 96529788 |
| Molecular Formula | C17H21ClN4O3 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | (2R)-2-[(9aR)-6,7-dioxo-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-N-[(2-chlorophenyl)methyl]propanamide |
| SMILES | C[C@H](C(=O)NCc1ccccc1Cl)N1CCN2C(=O)C(=O)NC[C@@H]2C1 |
| InChI | InChI=1S/C17H21ClN4O3/c1-11(15(23)19-8-12-4-2-3-5-14(12)18)21-6-7-22-13(10-21)9-20-16(24)17(22)25/h2-5,11,13H,6-10H2,1H3,(H,19,23)(H,20,24)/t11-,13-/m1/s1 |
| InChIKey | RCXJDKMLCWHKPN-DGCLKSJQSA-N |
| XLogP | -0.01 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|