C20H22BrNO3S — CID 96537350
(2R)-3-(4-bromophenyl)sulfonyl-N-[(R)-cyclopropyl(phenyl)methyl]-2-methylpropanamide (PubChem CID 96537350) has the molecular formula C20H22BrNO3S and a molecular weight of 436.37 g/mol. Its IUPAC name is (2R)-3-(4-bromophenyl)sulfonyl-N-[(R)-cyclopropyl(phenyl)methyl]-2-methylpropanamide.
| Compound Name | (2R)-3-(4-bromophenyl)sulfonyl-N-[(R)-cyclopropyl(phenyl)methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 96537350 |
| Molecular Formula | C20H22BrNO3S |
| Molecular Weight | 436.37 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | (2R)-3-(4-bromophenyl)sulfonyl-N-[(R)-cyclopropyl(phenyl)methyl]-2-methylpropanamide |
| SMILES | C[C@@H](CS(=O)(=O)c1ccc(Br)cc1)C(=O)N[C@@H](c1ccccc1)C1CC1 |
| InChI | InChI=1S/C20H22BrNO3S/c1-14(13-26(24,25)18-11-9-17(21)10-12-18)20(23)22-19(16-7-8-16)15-5-3-2-4-6-15/h2-6,9-12,14,16,19H,7-8,13H2,1H3,(H,22,23)/t14-,19-/m0/s1 |
| InChIKey | DPTGUULTTCLXHA-LIRRHRJNSA-N |
| XLogP | 4.13 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |