C18H26N4O3 — CID 96537549
7-nitro-N-[[(3S)-1-propylpyrrolidin-3-yl]methyl]-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 96537549) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 7-nitro-N-[[(3S)-1-propylpyrrolidin-3-yl]methyl]-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | 7-nitro-N-[[(3S)-1-propylpyrrolidin-3-yl]methyl]-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 96537549 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 7-nitro-N-[[(3S)-1-propylpyrrolidin-3-yl]methyl]-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | CCCN1CC[C@@H](CNC(=O)N2CCc3ccc([N+](=O)[O-])cc3C2)C1 |
| InChI | InChI=1S/C18H26N4O3/c1-2-7-20-8-5-14(12-20)11-19-18(23)21-9-6-15-3-4-17(22(24)25)10-16(15)13-21/h3-4,10,14H,2,5-9,11-13H2,1H3,(H,19,23)/t14-/m0/s1 |
| InChIKey | KDGFEHBFSJHERH-AWEZNQCLSA-N |
| XLogP | 2.39 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|