About (2R)-N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-methyloxolane-2-carboxamide
(2R)-N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-methyloxolane-2-carboxamide (PubChem CID 96537558) has the molecular formula C15H18ClNO2
and a molecular weight of 279.77 g/mol. Its IUPAC name is (2R)-N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-methyloxolane-2-carboxamide.
Molecular Properties
| Compound Name | (2R)-N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-methyloxolane-2-carboxamide |
| PubChem CID | 96537558 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | (2R)-N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-methyloxolane-2-carboxamide |
| SMILES | C[C@]1(C(=O)N[C@H]2CCc3cc(Cl)ccc32)CCCO1 |
| InChI | InChI=1S/C15H18ClNO2/c1-15(7-2-8-19-15)14(18)17-13-6-3-10-9-11(16)4-5-12(10)13/h4-5,9,13H,2-3,6-8H2,1H3,(H,17,18)/t13-,15+/m0/s1 |
| InChIKey | POFRGXGEXYNXJZ-DZGCQCFKSA-N |
| XLogP | 3.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-methyloxolane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-methyloxolane-2-carboxamide?
The IUPAC name of (2R)-N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-methyloxolane-2-carboxamide (CID 96537558) is (2R)-N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-methyloxolane-2-carboxamide.
What is the SMILES notation for (2R)-N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-methyloxolane-2-carboxamide?
The canonical SMILES for (2R)-N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-methyloxolane-2-carboxamide is C[C@]1(C(=O)N[C@H]2CCc3cc(Cl)ccc32)CCCO1.
What is the InChIKey of (2R)-N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-methyloxolane-2-carboxamide?
The InChIKey is POFRGXGEXYNXJZ-DZGCQCFKSA-N. The full InChI is InChI=1S/C15H18ClNO2/c1-15(7-2-8-19-15)14(18)17-13-6-3-10-9-11(16)4-5-12(10)13/h4-5,9,13H,2-3,6-8H2,1H3,(H,17,18)/t13-,15+/m0/s1.
What are the key properties of (2R)-N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-methyloxolane-2-carboxamide?
(2R)-N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-methyloxolane-2-carboxamide has a molecular weight of 279.77 g/mol, XLogP of 3.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-2-methyloxolane-2-carboxamide is sourced from PubChem (CID 96537558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).