C17H29N5O3 — CID 96539659
N-[3-(dimethylamino)-2,2-dimethylpropyl]-N'-[1-[[(2R)-oxolan-2-yl]methyl]pyrazol-4-yl]oxamide (PubChem CID 96539659) has the molecular formula C17H29N5O3 and a molecular weight of 351.45 g/mol. Its IUPAC name is N-[3-(dimethylamino)-2,2-dimethylpropyl]-N'-[1-[[(2R)-oxolan-2-yl]methyl]pyrazol-4-yl]oxamide.
| Compound Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-N'-[1-[[(2R)-oxolan-2-yl]methyl]pyrazol-4-yl]oxamide |
|---|---|
| PubChem CID | 96539659 |
| Molecular Formula | C17H29N5O3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-N'-[1-[[(2R)-oxolan-2-yl]methyl]pyrazol-4-yl]oxamide |
| SMILES | CN(C)CC(C)(C)CNC(=O)C(=O)Nc1cnn(C[C@H]2CCCO2)c1 |
| InChI | InChI=1S/C17H29N5O3/c1-17(2,12-21(3)4)11-18-15(23)16(24)20-13-8-19-22(9-13)10-14-6-5-7-25-14/h8-9,14H,5-7,10-12H2,1-4H3,(H,18,23)(H,20,24)/t14-/m1/s1 |
| InChIKey | CSMCXKOFOWDDJT-CQSZACIVSA-N |
| XLogP | 0.70 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|