C15H19F3N2O3 — CID 96539789
N-[(3S)-8-methoxy-3,4-dihydro-2H-chromen-3-yl]-3-(2,2,2-trifluoroethylamino)propanamide (PubChem CID 96539789) has the molecular formula C15H19F3N2O3 and a molecular weight of 332.32 g/mol. Its IUPAC name is N-[(3S)-8-methoxy-3,4-dihydro-2H-chromen-3-yl]-3-(2,2,2-trifluoroethylamino)propanamide.
| Compound Name | N-[(3S)-8-methoxy-3,4-dihydro-2H-chromen-3-yl]-3-(2,2,2-trifluoroethylamino)propanamide |
|---|---|
| PubChem CID | 96539789 |
| Molecular Formula | C15H19F3N2O3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-[(3S)-8-methoxy-3,4-dihydro-2H-chromen-3-yl]-3-(2,2,2-trifluoroethylamino)propanamide |
| SMILES | COc1cccc2c1OC[C@@H](NC(=O)CCNCC(F)(F)F)C2 |
| InChI | InChI=1S/C15H19F3N2O3/c1-22-12-4-2-3-10-7-11(8-23-14(10)12)20-13(21)5-6-19-9-15(16,17)18/h2-4,11,19H,5-9H2,1H3,(H,20,21)/t11-/m0/s1 |
| InChIKey | QYXQVZIXHUGCRW-NSHDSACASA-N |
| XLogP | 1.66 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|