C17H21N5O2 — CID 96540089
(3R)-3-N-[2-(2-methylphenyl)pyrazol-3-yl]piperidine-1,3-dicarboxamide (PubChem CID 96540089) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is (3R)-3-N-[2-(2-methylphenyl)pyrazol-3-yl]piperidine-1,3-dicarboxamide.
| Compound Name | (3R)-3-N-[2-(2-methylphenyl)pyrazol-3-yl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 96540089 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | (3R)-3-N-[2-(2-methylphenyl)pyrazol-3-yl]piperidine-1,3-dicarboxamide |
| SMILES | Cc1ccccc1-n1nccc1NC(=O)[C@@H]1CCCN(C(N)=O)C1 |
| InChI | InChI=1S/C17H21N5O2/c1-12-5-2-3-7-14(12)22-15(8-9-19-22)20-16(23)13-6-4-10-21(11-13)17(18)24/h2-3,5,7-9,13H,4,6,10-11H2,1H3,(H2,18,24)(H,20,23)/t13-/m1/s1 |
| InChIKey | JXBMXCBXPLDTMQ-CYBMUJFWSA-N |
| XLogP | 1.91 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |