C18H22N4O4 — CID 96541607
(4aR,8aS)-3-oxo-N-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-2,4,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxamide (PubChem CID 96541607) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is (4aR,8aS)-3-oxo-N-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-2,4,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxamide.
| Compound Name | (4aR,8aS)-3-oxo-N-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-2,4,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxamide |
|---|---|
| PubChem CID | 96541607 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | (4aR,8aS)-3-oxo-N-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-2,4,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxamide |
| SMILES | O=C1CN(C(=O)Nc2cccc(N3CCOC3=O)c2)[C@H]2CCCC[C@H]2N1 |
| InChI | InChI=1S/C18H22N4O4/c23-16-11-22(15-7-2-1-6-14(15)20-16)17(24)19-12-4-3-5-13(10-12)21-8-9-26-18(21)25/h3-5,10,14-15H,1-2,6-9,11H2,(H,19,24)(H,20,23)/t14-,15+/m1/s1 |
| InChIKey | YZXBLKKLIQCJKE-CABCVRRESA-N |
| XLogP | 1.92 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |