C16H17ClN4O2 — CID 97076862
(4aS,8aR)-N-(3-chloro-4-cyanophenyl)-3-oxo-2,4,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxamide (PubChem CID 97076862) has the molecular formula C16H17ClN4O2 and a molecular weight of 332.79 g/mol. Its IUPAC name is (4aS,8aR)-N-(3-chloro-4-cyanophenyl)-3-oxo-2,4,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxamide.
| Compound Name | (4aS,8aR)-N-(3-chloro-4-cyanophenyl)-3-oxo-2,4,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxamide |
|---|---|
| PubChem CID | 97076862 |
| Molecular Formula | C16H17ClN4O2 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | (4aS,8aR)-N-(3-chloro-4-cyanophenyl)-3-oxo-2,4,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)N2CC(=O)N[C@H]3CCCC[C@H]32)cc1Cl |
| InChI | InChI=1S/C16H17ClN4O2/c17-12-7-11(6-5-10(12)8-18)19-16(23)21-9-15(22)20-13-3-1-2-4-14(13)21/h5-7,13-14H,1-4,9H2,(H,19,23)(H,20,22)/t13-,14+/m0/s1 |
| InChIKey | DYCMYKMYXNTLND-UONOGXRCSA-N |
| XLogP | 2.49 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |