C19H20N2O3S2 — CID 96541833
6-[[(2S,3S)-2,3-dimethyl-2,3-dihydro-1,4-benzothiazin-4-yl]sulfonyl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 96541833) has the molecular formula C19H20N2O3S2 and a molecular weight of 388.51 g/mol. Its IUPAC name is 6-[[(2S,3S)-2,3-dimethyl-2,3-dihydro-1,4-benzothiazin-4-yl]sulfonyl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[[(2S,3S)-2,3-dimethyl-2,3-dihydro-1,4-benzothiazin-4-yl]sulfonyl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 96541833 |
| Molecular Formula | C19H20N2O3S2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 6-[[(2S,3S)-2,3-dimethyl-2,3-dihydro-1,4-benzothiazin-4-yl]sulfonyl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | C[C@@H]1Sc2ccccc2N(S(=O)(=O)c2ccc3c(c2)CCC(=O)N3)[C@H]1C |
| InChI | InChI=1S/C19H20N2O3S2/c1-12-13(2)25-18-6-4-3-5-17(18)21(12)26(23,24)15-8-9-16-14(11-15)7-10-19(22)20-16/h3-6,8-9,11-13H,7,10H2,1-2H3,(H,20,22)/t12-,13-/m0/s1 |
| InChIKey | OKTOOHYSOLGZFO-STQMWFEESA-N |
| XLogP | 3.65 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |