C21H26N4O3 — CID 96542255
2-N-[(1S)-1-[(2R)-4-benzylmorpholin-2-yl]propyl]pyridine-2,5-dicarboxamide (PubChem CID 96542255) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-N-[(1S)-1-[(2R)-4-benzylmorpholin-2-yl]propyl]pyridine-2,5-dicarboxamide.
| Compound Name | 2-N-[(1S)-1-[(2R)-4-benzylmorpholin-2-yl]propyl]pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 96542255 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 2-N-[(1S)-1-[(2R)-4-benzylmorpholin-2-yl]propyl]pyridine-2,5-dicarboxamide |
| SMILES | CC[C@H](NC(=O)c1ccc(C(N)=O)cn1)[C@H]1CN(Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C21H26N4O3/c1-2-17(24-21(27)18-9-8-16(12-23-18)20(22)26)19-14-25(10-11-28-19)13-15-6-4-3-5-7-15/h3-9,12,17,19H,2,10-11,13-14H2,1H3,(H2,22,26)(H,24,27)/t17-,19+/m0/s1 |
| InChIKey | QBPBTUMGFUGTPH-PKOBYXMFSA-N |
| XLogP | 1.59 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |