C17H22N4O2S — CID 97095923
N-[(1R)-1-[(2S)-4-benzylmorpholin-2-yl]propyl]thiadiazole-4-carboxamide (PubChem CID 97095923) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is N-[(1R)-1-[(2S)-4-benzylmorpholin-2-yl]propyl]thiadiazole-4-carboxamide.
| Compound Name | N-[(1R)-1-[(2S)-4-benzylmorpholin-2-yl]propyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 97095923 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-[(1R)-1-[(2S)-4-benzylmorpholin-2-yl]propyl]thiadiazole-4-carboxamide |
| SMILES | CC[C@@H](NC(=O)c1csnn1)[C@@H]1CN(Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C17H22N4O2S/c1-2-14(18-17(22)15-12-24-20-19-15)16-11-21(8-9-23-16)10-13-6-4-3-5-7-13/h3-7,12,14,16H,2,8-11H2,1H3,(H,18,22)/t14-,16+/m1/s1 |
| InChIKey | RRPROMFRDPMORY-ZBFHGGJFSA-N |
| XLogP | 1.95 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |