C15H22N2O3S — CID 96542541
methyl (2S)-4-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-ylamino)-2-methyl-4-oxobutanoate (PubChem CID 96542541) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is methyl (2S)-4-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-ylamino)-2-methyl-4-oxobutanoate.
| Compound Name | methyl (2S)-4-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-ylamino)-2-methyl-4-oxobutanoate |
|---|---|
| PubChem CID | 96542541 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | methyl (2S)-4-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-ylamino)-2-methyl-4-oxobutanoate |
| SMILES | COC(=O)[C@@H](C)CC(=O)Nc1nc2c(s1)CCCCCC2 |
| InChI | InChI=1S/C15H22N2O3S/c1-10(14(19)20-2)9-13(18)17-15-16-11-7-5-3-4-6-8-12(11)21-15/h10H,3-9H2,1-2H3,(H,16,17,18)/t10-/m0/s1 |
| InChIKey | MONGQKJRFIZZLD-JTQLQIEISA-N |
| XLogP | 2.94 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |