C18H24O3 — CID 96542911
[(3S)-hept-6-yn-3-yl] (3R)-3-(2-methoxyphenyl)butanoate (PubChem CID 96542911) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is [(3S)-hept-6-yn-3-yl] (3R)-3-(2-methoxyphenyl)butanoate.
| Compound Name | [(3S)-hept-6-yn-3-yl] (3R)-3-(2-methoxyphenyl)butanoate |
|---|---|
| PubChem CID | 96542911 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | [(3S)-hept-6-yn-3-yl] (3R)-3-(2-methoxyphenyl)butanoate |
| SMILES | C#CCC[C@H](CC)OC(=O)C[C@@H](C)c1ccccc1OC |
| InChI | InChI=1S/C18H24O3/c1-5-7-10-15(6-2)21-18(19)13-14(3)16-11-8-9-12-17(16)20-4/h1,8-9,11-12,14-15H,6-7,10,13H2,2-4H3/t14-,15+/m1/s1 |
| InChIKey | CESXXTCMKNIMRV-CABCVRRESA-N |
| XLogP | 3.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|