C21H25NO7S — CID 96544484
N-[(3R)-1,1-dioxothiolan-3-yl]-2-[(4,8,8-trimethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetamide (PubChem CID 96544484) has the molecular formula C21H25NO7S and a molecular weight of 435.50 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-2-[(4,8,8-trimethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-[(4,8,8-trimethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetamide |
|---|---|
| PubChem CID | 96544484 |
| Molecular Formula | C21H25NO7S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-[(4,8,8-trimethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetamide |
| SMILES | Cc1cc(=O)oc2c3c(cc(OCC(=O)N[C@@H]4CCS(=O)(=O)C4)c12)OC(C)(C)CC3 |
| InChI | InChI=1S/C21H25NO7S/c1-12-8-18(24)28-20-14-4-6-21(2,3)29-15(14)9-16(19(12)20)27-10-17(23)22-13-5-7-30(25,26)11-13/h8-9,13H,4-7,10-11H2,1-3H3,(H,22,23)/t13-/m1/s1 |
| InChIKey | VMSZULJGGDPUEA-CYBMUJFWSA-N |
| XLogP | 1.89 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|